| Name | proparacaine hydrochloride |
| Synonyms | alcaine Proparacaine Hcl PROPARACAINE HCL proparacaine hydrochloride PROPARACAINE HYDROCHLORIDE proxymetacaine hydrochloride beta-(diethylamino)ethyl3-amino-4-n-propoxybenzoatehydrochloride 2-[(3-amino-4-propoxybenzoyl)oxy]-N,N-diethylethanaminium chloride 3-amino-4-propoxybenzoicacid2-(diethylamino)ethylesterhydrochloride 2-[(3-amino-4-propoxyphenyl)-oxomethoxy]ethyl-diethylammonium chloride benzoicacid,3-amino-4-propoxy-,2-(diethylamino)ethylester,hydrochloride benzoicacid,3-amino-4-propoxy-,2-(diethylamino)ethylester,monohydrochlorid |
| CAS | 5875-06-9 |
| EINECS | 227-541-7 |
| InChI | InChI=1/C16H26N2O3.ClH/c1-4-10-20-15-8-7-13(12-14(15)17)16(19)21-11-9-18(5-2)6-3;/h7-8,12H,4-6,9-11,17H2,1-3H3;1H |
| Molecular Formula | C16H27ClN2O3 |
| Molar Mass | 330.85 |
| Melting Point | 182.0-183.3° |
| Boling Point | 434.4°C at 760 mmHg |
| Flash Point | 216.5°C |
| Solubility | Chloroform (Slightly), Methanol, Water |
| Vapor Presure | 9.5E-08mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| Maximum wavelength(λmax) | ['300nm(MeOH)(lit.)'] |
| Merck | 14,7807 |
| pKa | 3.2(at 25℃) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| In vitro study | Proparacaine is more potent than cocaine but less toxic. The Ct values of Proparacaine in FHV-1 (P < 0.01), C. felis and 8S rDNA were significantly increased when fusidic acid was used. |
| In vivo study | Proparacain inhibits corneal epithelial cell migration and adhesion by altering the actin cytoskeleton. Proparacaine, like bupivacaine or lidocaine, can anesthetize the spinal cord and lose motor function, muscle motion perception, and nociception. Intrathecal proparacaine was more strongly anesthetized for the senses than for motor abilities. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36 - Irritating to the eyes R43 - May cause sensitization by skin contact |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | DG3065000 |
| HS Code | 2922504500 |